C8H10NRb — CID 59014573
rubidium(1+);4,5,6-trimethyl-3H-pyridin-3-ide (PubChem CID 59014573) has the molecular formula C8H10NRb and a molecular weight of 205.64 g/mol. Its IUPAC name is rubidium(1+);4,5,6-trimethyl-3H-pyridin-3-ide.
| Compound Name | rubidium(1+);4,5,6-trimethyl-3H-pyridin-3-ide |
|---|---|
| PubChem CID | 59014573 |
| Molecular Formula | C8H10NRb |
| Molecular Weight | 205.64 g/mol |
| Exact Mass | 204.99 |
| IUPAC Name | rubidium(1+);4,5,6-trimethyl-3H-pyridin-3-ide |
| SMILES | Cc1[c-]cnc(C)c1C.[Rb+] |
| InChI | InChI=1S/C8H10N.Rb/c1-6-4-5-9-8(3)7(6)2;/h5H,1-3H3;/q-1;+1 |
| InChIKey | FZNJCNKVSKJBOY-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.64 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|