C8H10LiN — CID 23395990
lithium 2,3,5-trimethyl-4H-pyridin-4-ide (PubChem CID 23395990) has the molecular formula C8H10LiN and a molecular weight of 127.12 g/mol. Its IUPAC name is lithium 2,3,5-trimethyl-4H-pyridin-4-ide.
| Compound Name | lithium 2,3,5-trimethyl-4H-pyridin-4-ide |
|---|---|
| PubChem CID | 23395990 |
| Molecular Formula | C8H10LiN |
| Molecular Weight | 127.12 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | lithium 2,3,5-trimethyl-4H-pyridin-4-ide |
| SMILES | Cc1[c-]c(C)c(C)nc1.[Li+] |
| InChI | InChI=1S/C8H10N.Li/c1-6-4-7(2)8(3)9-5-6;/h5H,1-3H3;/q-1;+1 |
| InChIKey | FTQNYSASNZAIBV-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.12 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|