C13H13N3 — CID 163864159
[(4E)-4-(1-cyanopropylidene)-2,5-dimethylcyclohexa-2,5-dien-1-ylidene]cyanamide (PubChem CID 163864159) has the molecular formula C13H13N3 and a molecular weight of 211.27 g/mol. Its IUPAC name is [(4E)-4-(1-cyanopropylidene)-2,5-dimethylcyclohexa-2,5-dien-1-ylidene]cyanamide.
| Compound Name | [(4E)-4-(1-cyanopropylidene)-2,5-dimethylcyclohexa-2,5-dien-1-ylidene]cyanamide |
|---|---|
| PubChem CID | 163864159 |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | [(4E)-4-(1-cyanopropylidene)-2,5-dimethylcyclohexa-2,5-dien-1-ylidene]cyanamide |
| SMILES | CC/C(C#N)=C1/C=C(C)/C(=N/C#N)C=C1C |
| InChI | InChI=1S/C13H13N3/c1-4-11(7-14)12-5-10(3)13(16-8-15)6-9(12)2/h5-6H,4H2,1-3H3/b12-11+,16-13+ |
| InChIKey | PFDXULSTBMYVQQ-VUWKKMCJSA-N |
| XLogP | 3.04 |
| TPSA | 59.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|