C10H9N3 — CID 91110057
2-(2,6-dimethyl-3H-pyridin-4-ylidene)propanedinitrile (PubChem CID 91110057) has the molecular formula C10H9N3 and a molecular weight of 171.20 g/mol. Its IUPAC name is 2-(2,6-dimethyl-3H-pyridin-4-ylidene)propanedinitrile.
| Compound Name | 2-(2,6-dimethyl-3H-pyridin-4-ylidene)propanedinitrile |
|---|---|
| PubChem CID | 91110057 |
| Molecular Formula | C10H9N3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 2-(2,6-dimethyl-3H-pyridin-4-ylidene)propanedinitrile |
| SMILES | CC1=CC(=C(C#N)C#N)CC(C)=N1 |
| InChI | InChI=1S/C10H9N3/c1-7-3-9(4-8(2)13-7)10(5-11)6-12/h3H,4H2,1-2H3 |
| InChIKey | YCVBJXDZCAOPMP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 59.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|