C16H26N2 — CID 142562020
(E)-4-methyl-2-propan-2-ylidene-5-prop-1-en-2-yliminohex-3-enenitrile;propane (PubChem CID 142562020) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is (E)-4-methyl-2-propan-2-ylidene-5-prop-1-en-2-yliminohex-3-enenitrile;propane.
| Compound Name | (E)-4-methyl-2-propan-2-ylidene-5-prop-1-en-2-yliminohex-3-enenitrile;propane |
|---|---|
| PubChem CID | 142562020 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | (E)-4-methyl-2-propan-2-ylidene-5-prop-1-en-2-yliminohex-3-enenitrile;propane |
| SMILES | C=C(C)/N=C(C)/C(C)=C/C(C#N)=C(C)C.CCC |
| InChI | InChI=1S/C13H18N2.C3H8/c1-9(2)13(8-14)7-11(5)12(6)15-10(3)4;1-3-2/h7H,3H2,1-2,4-6H3;3H2,1-2H3/b11-7+,15-12+; |
| InChIKey | IYENTCNHZIKIHL-ZZGPTTHSSA-N |
| XLogP | 5.20 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|