C16H17F3N2 — CID 144502043
(2E,4E)-2-ethenyl-4-[1-[[(E)-3-(trifluoromethyl)pent-3-en-2-ylidene]amino]ethenyl]hexa-2,4-dienenitrile (PubChem CID 144502043) has the molecular formula C16H17F3N2 and a molecular weight of 294.32 g/mol. Its IUPAC name is (2E,4E)-2-ethenyl-4-[1-[[(E)-3-(trifluoromethyl)pent-3-en-2-ylidene]amino]ethenyl]hexa-2,4-dienenitrile.
| Compound Name | (2E,4E)-2-ethenyl-4-[1-[[(E)-3-(trifluoromethyl)pent-3-en-2-ylidene]amino]ethenyl]hexa-2,4-dienenitrile |
|---|---|
| PubChem CID | 144502043 |
| Molecular Formula | C16H17F3N2 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (2E,4E)-2-ethenyl-4-[1-[[(E)-3-(trifluoromethyl)pent-3-en-2-ylidene]amino]ethenyl]hexa-2,4-dienenitrile |
| SMILES | C=C/C(C#N)=C\C(=C/C)C(=C)/N=C(C)/C(=C\C)C(F)(F)F |
| InChI | InChI=1S/C16H17F3N2/c1-6-13(10-20)9-14(7-2)11(4)21-12(5)15(8-3)16(17,18)19/h6-9H,1,4H2,2-3,5H3/b13-9+,14-7+,15-8+,21-12+ |
| InChIKey | BNIBBALMQQSZQI-USVPVYNHSA-N |
| XLogP | 5.05 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|