C15H16N2 — CID 164967406
(2E)-2-[(Z)-(5,6-dimethyl-2-methylidene-3-pyridinylidene)methyl]-4-methylpenta-2,4-dienenitrile (PubChem CID 164967406) has the molecular formula C15H16N2 and a molecular weight of 224.31 g/mol. Its IUPAC name is (2E)-2-[(Z)-(5,6-dimethyl-2-methylidene-3-pyridinylidene)methyl]-4-methylpenta-2,4-dienenitrile.
| Compound Name | (2E)-2-[(Z)-(5,6-dimethyl-2-methylidene-3-pyridinylidene)methyl]-4-methylpenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 164967406 |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | (2E)-2-[(Z)-(5,6-dimethyl-2-methylidene-3-pyridinylidene)methyl]-4-methylpenta-2,4-dienenitrile |
| SMILES | C=C(C)/C=C(C#N)\C=c1\cc(C)c(C)nc1=C |
| InChI | InChI=1S/C15H16N2/c1-10(2)6-14(9-16)8-15-7-11(3)12(4)17-13(15)5/h6-8H,1,5H2,2-4H3/b14-6+,15-8- |
| InChIKey | CQVQBJIUCOVKMK-PYIQRHLKSA-N |
| XLogP | 1.92 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|