C22H30N2 — CID 123221201
(4E,8E)-2,5,6,9-tetramethyl-10-[[(Z)-2-methylhex-4-en-3-ylidene]amino]undeca-2,4,6,8,10-pentaenenitrile (PubChem CID 123221201) has the molecular formula C22H30N2 and a molecular weight of 322.50 g/mol. Its IUPAC name is (4E,8E)-2,5,6,9-tetramethyl-10-[[(Z)-2-methylhex-4-en-3-ylidene]amino]undeca-2,4,6,8,10-pentaenenitrile.
| Compound Name | (4E,8E)-2,5,6,9-tetramethyl-10-[[(Z)-2-methylhex-4-en-3-ylidene]amino]undeca-2,4,6,8,10-pentaenenitrile |
|---|---|
| PubChem CID | 123221201 |
| Molecular Formula | C22H30N2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | (4E,8E)-2,5,6,9-tetramethyl-10-[[(Z)-2-methylhex-4-en-3-ylidene]amino]undeca-2,4,6,8,10-pentaenenitrile |
| SMILES | C=C(/N=C(/C=C\C)C(C)C)/C(C)=C/C=C(C)/C(C)=C/C=C(C)C#N |
| InChI | InChI=1S/C22H30N2/c1-9-10-22(16(2)3)24-21(8)20(7)14-13-19(6)18(5)12-11-17(4)15-23/h9-14,16H,8H2,1-7H3/b10-9-,17-11?,18-12+,19-13?,20-14+,24-22- |
| InChIKey | YWZZFAXDMJPXIA-LASAUSILSA-N |
| XLogP | 6.48 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|