C9H11N — CID 123297259
2,3-dimethyl-5,6-dimethylidenepyridine (PubChem CID 123297259) has the molecular formula C9H11N and a molecular weight of 133.19 g/mol. Its IUPAC name is 2,3-dimethyl-5,6-dimethylidenepyridine.
| Compound Name | 2,3-dimethyl-5,6-dimethylidenepyridine |
|---|---|
| PubChem CID | 123297259 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | 2,3-dimethyl-5,6-dimethylidenepyridine |
| SMILES | C=c1cc(C)c(C)nc1=C |
| InChI | InChI=1S/C9H11N/c1-6-5-7(2)9(4)10-8(6)3/h5H,1,3H2,2,4H3 |
| InChIKey | BPTLKVNPSQZVKZ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |