C11H13F3N2 — CID 168972736
(E)-5,5,5-trifluoro-2-methyl-4-[(E)-pent-2-en-2-yl]iminopent-2-enenitrile (PubChem CID 168972736) has the molecular formula C11H13F3N2 and a molecular weight of 230.23 g/mol. Its IUPAC name is (E)-5,5,5-trifluoro-2-methyl-4-[(E)-pent-2-en-2-yl]iminopent-2-enenitrile.
| Compound Name | (E)-5,5,5-trifluoro-2-methyl-4-[(E)-pent-2-en-2-yl]iminopent-2-enenitrile |
|---|---|
| PubChem CID | 168972736 |
| Molecular Formula | C11H13F3N2 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | (E)-5,5,5-trifluoro-2-methyl-4-[(E)-pent-2-en-2-yl]iminopent-2-enenitrile |
| SMILES | CC/C=C(C)/N=C(/C=C(\C)C#N)C(F)(F)F |
| InChI | InChI=1S/C11H13F3N2/c1-4-5-9(3)16-10(11(12,13)14)6-8(2)7-15/h5-6H,4H2,1-3H3/b8-6+,9-5+,16-10- |
| InChIKey | IAUHLSDAHWQSKB-HAMKQYKTSA-N |
| XLogP | 3.77 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|