C11H10F9N — CID 167231762
(E)-1,1,1,5,5,5-hexafluoro-4-methyl-N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]pent-3-en-2-imine (PubChem CID 167231762) has the molecular formula C11H10F9N and a molecular weight of 327.19 g/mol. Its IUPAC name is (E)-1,1,1,5,5,5-hexafluoro-4-methyl-N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]pent-3-en-2-imine.
| Compound Name | (E)-1,1,1,5,5,5-hexafluoro-4-methyl-N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]pent-3-en-2-imine |
|---|---|
| PubChem CID | 167231762 |
| Molecular Formula | C11H10F9N |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | (E)-1,1,1,5,5,5-hexafluoro-4-methyl-N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]pent-3-en-2-imine |
| SMILES | CC/C=C(\N=C(\C=C(/C)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H10F9N/c1-3-4-7(10(15,16)17)21-8(11(18,19)20)5-6(2)9(12,13)14/h4-5H,3H2,1-2H3/b6-5+,7-4-,21-8- |
| InChIKey | KAJJEYDVJLSVEM-JUGZMCPWSA-N |
| XLogP | 5.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|