C15H18F3N — CID 142147282
(E)-N-[(3E,5Z)-3-ethenylhepta-1,3,5-trien-2-yl]-5,5,5-trifluoro-4-methylpent-3-en-2-imine (PubChem CID 142147282) has the molecular formula C15H18F3N and a molecular weight of 269.30 g/mol. Its IUPAC name is (E)-N-[(3E,5Z)-3-ethenylhepta-1,3,5-trien-2-yl]-5,5,5-trifluoro-4-methylpent-3-en-2-imine.
| Compound Name | (E)-N-[(3E,5Z)-3-ethenylhepta-1,3,5-trien-2-yl]-5,5,5-trifluoro-4-methylpent-3-en-2-imine |
|---|---|
| PubChem CID | 142147282 |
| Molecular Formula | C15H18F3N |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | (E)-N-[(3E,5Z)-3-ethenylhepta-1,3,5-trien-2-yl]-5,5,5-trifluoro-4-methylpent-3-en-2-imine |
| SMILES | C/C=C\C=C(/C=C)\C(=C)N=C(C)/C=C(\C)/C(F)(F)F |
| InChI | InChI=1S/C15H18F3N/c1-6-8-9-14(7-2)13(5)19-12(4)10-11(3)15(16,17)18/h6-10H,2,5H2,1,3-4H3/b8-6-,11-10+,14-9+,19-12? |
| InChIKey | OTHRFPWWMNIAQD-NTNLPYGASA-N |
| XLogP | 5.40 |
| TPSA | 12.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | 460 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|