C9H12N2 — CID 139385990
(2E)-2-(C,N-dimethylcarbonimidoyl)-4-methylpenta-2,4-dienenitrile (PubChem CID 139385990) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is (2E)-2-(C,N-dimethylcarbonimidoyl)-4-methylpenta-2,4-dienenitrile.
| Compound Name | (2E)-2-(C,N-dimethylcarbonimidoyl)-4-methylpenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 139385990 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | (2E)-2-(C,N-dimethylcarbonimidoyl)-4-methylpenta-2,4-dienenitrile |
| SMILES | C=C(C)/C=C(C#N)\C(C)=N\C |
| InChI | InChI=1S/C9H12N2/c1-7(2)5-9(6-10)8(3)11-4/h5H,1H2,2-4H3/b9-5-,11-8+ |
| InChIKey | FDCKEEOXHKMYIQ-WZGGBKBVSA-N |
| XLogP | 2.10 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|