C10H16N2 — CID 123328094
(E)-2-(C,N-dimethylcarbonimidoyl)hept-2-enenitrile (PubChem CID 123328094) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is (E)-2-(C,N-dimethylcarbonimidoyl)hept-2-enenitrile.
| Compound Name | (E)-2-(C,N-dimethylcarbonimidoyl)hept-2-enenitrile |
|---|---|
| PubChem CID | 123328094 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | (E)-2-(C,N-dimethylcarbonimidoyl)hept-2-enenitrile |
| SMILES | CCCC/C=C(C#N)\C(C)=N\C |
| InChI | InChI=1S/C10H16N2/c1-4-5-6-7-10(8-11)9(2)12-3/h7H,4-6H2,1-3H3/b10-7-,12-9+ |
| InChIKey | BFSOWMOAPRQYRZ-PWZCAXEFSA-N |
| XLogP | 2.72 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|