About 2,7-dimethyl-3,4-dihydro-2H-azepine-6-carbonitrile
2,7-dimethyl-3,4-dihydro-2H-azepine-6-carbonitrile (PubChem CID 123918081) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 2,7-dimethyl-3,4-dihydro-2H-azepine-6-carbonitrile.
Analyze 2,7-dimethyl-3,4-dihydro-2H-azepine-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dimethyl-3,4-dihydro-2H-azepine-6-carbonitrile?
The IUPAC name of 2,7-dimethyl-3,4-dihydro-2H-azepine-6-carbonitrile (CID 123918081) is 2,7-dimethyl-3,4-dihydro-2H-azepine-6-carbonitrile.
What is the SMILES notation for 2,7-dimethyl-3,4-dihydro-2H-azepine-6-carbonitrile?
The canonical SMILES for 2,7-dimethyl-3,4-dihydro-2H-azepine-6-carbonitrile is CC1=NC(C)CCC=C1C#N.
What is the InChIKey of 2,7-dimethyl-3,4-dihydro-2H-azepine-6-carbonitrile?
The InChIKey is UUAFYNQJJKMHGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2/c1-7-4-3-5-9(6-10)8(2)11-7/h5,7H,3-4H2,1-2H3.
What are the key properties of 2,7-dimethyl-3,4-dihydro-2H-azepine-6-carbonitrile?
2,7-dimethyl-3,4-dihydro-2H-azepine-6-carbonitrile has a molecular weight of 148.21 g/mol, XLogP of 2.08, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethyl-3,4-dihydro-2H-azepine-6-carbonitrile is sourced from PubChem (CID 123918081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).