About 2,4-dimethyl-2,3-dihydropyridine-6-carbonitrile
2,4-dimethyl-2,3-dihydropyridine-6-carbonitrile (PubChem CID 143620826) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is 2,4-dimethyl-2,3-dihydropyridine-6-carbonitrile.
Analyze 2,4-dimethyl-2,3-dihydropyridine-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-2,3-dihydropyridine-6-carbonitrile?
The IUPAC name of 2,4-dimethyl-2,3-dihydropyridine-6-carbonitrile (CID 143620826) is 2,4-dimethyl-2,3-dihydropyridine-6-carbonitrile.
What is the SMILES notation for 2,4-dimethyl-2,3-dihydropyridine-6-carbonitrile?
The canonical SMILES for 2,4-dimethyl-2,3-dihydropyridine-6-carbonitrile is CC1=CC(C#N)=NC(C)C1.
What is the InChIKey of 2,4-dimethyl-2,3-dihydropyridine-6-carbonitrile?
The InChIKey is VSCIWAIYYXPBOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2/c1-6-3-7(2)10-8(4-6)5-9/h4,7H,3H2,1-2H3.
What are the key properties of 2,4-dimethyl-2,3-dihydropyridine-6-carbonitrile?
2,4-dimethyl-2,3-dihydropyridine-6-carbonitrile has a molecular weight of 134.18 g/mol, XLogP of 1.69, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-2,3-dihydropyridine-6-carbonitrile is sourced from PubChem (CID 143620826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).