C9H15N — CID 123979509
5-ethyl-2,6-dimethyl-2,3-dihydropyridine (PubChem CID 123979509) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is 5-ethyl-2,6-dimethyl-2,3-dihydropyridine.
| Compound Name | 5-ethyl-2,6-dimethyl-2,3-dihydropyridine |
|---|---|
| PubChem CID | 123979509 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 5-ethyl-2,6-dimethyl-2,3-dihydropyridine |
| SMILES | CCC1=CCC(C)N=C1C |
| InChI | InChI=1S/C9H15N/c1-4-9-6-5-7(2)10-8(9)3/h6-7H,4-5H2,1-3H3 |
| InChIKey | KBENPRWQDZNKNK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |