C16H24N2 — CID 5365914
2-[[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]-4-methylpent-4-enenitrile (PubChem CID 5365914) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 2-[[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]-4-methylpent-4-enenitrile.
| Compound Name | 2-[[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]-4-methylpent-4-enenitrile |
|---|---|
| PubChem CID | 5365914 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 2-[[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]-4-methylpent-4-enenitrile |
| SMILES | C=C(C)CC(C#N)/N=C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C16H24N2/c1-13(2)7-6-8-15(5)9-10-18-16(12-17)11-14(3)4/h7,9-10,16H,3,6,8,11H2,1-2,4-5H3/b15-9+,18-10+ |
| InChIKey | RQQOVPYZFPIMTH-HJSNDYAYSA-N |
| XLogP | 4.61 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|