C14H17N3 — CID 5374302
2-[[(2E,4E)-3,7-dimethylocta-2,4,6-trienylidene]amino]butanedinitrile (PubChem CID 5374302) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is 2-[[(2E,4E)-3,7-dimethylocta-2,4,6-trienylidene]amino]butanedinitrile.
| Compound Name | 2-[[(2E,4E)-3,7-dimethylocta-2,4,6-trienylidene]amino]butanedinitrile |
|---|---|
| PubChem CID | 5374302 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 2-[[(2E,4E)-3,7-dimethylocta-2,4,6-trienylidene]amino]butanedinitrile |
| SMILES | CC(C)=C/C=C/C(C)=C/C=N/C(C#N)CC#N |
| InChI | InChI=1S/C14H17N3/c1-12(2)5-4-6-13(3)8-10-17-14(11-16)7-9-15/h4-6,8,10,14H,7H2,1-3H3/b6-4+,13-8+,17-10+ |
| InChIKey | PBJNJFZOZFQOFM-HTLLLTNPSA-N |
| XLogP | 3.33 |
| TPSA | 59.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|