C21H28N2 — CID 5378697
4-methyl-2-[[(2E,4E,6E,8E)-3,7,11-trimethyldodeca-2,4,6,8,10-pentaenylidene]amino]pent-4-enenitrile (PubChem CID 5378697) has the molecular formula C21H28N2 and a molecular weight of 308.47 g/mol. Its IUPAC name is 4-methyl-2-[[(2E,4E,6E,8E)-3,7,11-trimethyldodeca-2,4,6,8,10-pentaenylidene]amino]pent-4-enenitrile.
| Compound Name | 4-methyl-2-[[(2E,4E,6E,8E)-3,7,11-trimethyldodeca-2,4,6,8,10-pentaenylidene]amino]pent-4-enenitrile |
|---|---|
| PubChem CID | 5378697 |
| Molecular Formula | C21H28N2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | 4-methyl-2-[[(2E,4E,6E,8E)-3,7,11-trimethyldodeca-2,4,6,8,10-pentaenylidene]amino]pent-4-enenitrile |
| SMILES | C=C(C)CC(C#N)/N=C/C=C(C)/C=C/C=C(C)/C=C/C=C(C)C |
| InChI | InChI=1S/C21H28N2/c1-17(2)9-7-10-19(5)11-8-12-20(6)13-14-23-21(16-22)15-18(3)4/h7-14,21H,3,15H2,1-2,4-6H3/b10-7+,12-8+,19-11+,20-13+,23-14+ |
| InChIKey | PWOZHFPCCBVWIV-HJHILVOMSA-N |
| XLogP | 5.89 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|