C21H32N2 — CID 5362845
(3E)-2-[[(2Z)-3,7-dimethylocta-2,6-dienylidene]amino]-4,8-dimethylnona-3,7-dienenitrile (PubChem CID 5362845) has the molecular formula C21H32N2 and a molecular weight of 312.50 g/mol. Its IUPAC name is (3E)-2-[[(2Z)-3,7-dimethylocta-2,6-dienylidene]amino]-4,8-dimethylnona-3,7-dienenitrile.
| Compound Name | (3E)-2-[[(2Z)-3,7-dimethylocta-2,6-dienylidene]amino]-4,8-dimethylnona-3,7-dienenitrile |
|---|---|
| PubChem CID | 5362845 |
| Molecular Formula | C21H32N2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.26 |
| IUPAC Name | (3E)-2-[[(2Z)-3,7-dimethylocta-2,6-dienylidene]amino]-4,8-dimethylnona-3,7-dienenitrile |
| SMILES | CC(C)=CCC/C(C)=C\C=N\C(C#N)/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C21H32N2/c1-17(2)9-7-11-19(5)13-14-23-21(16-22)15-20(6)12-8-10-18(3)4/h9-10,13-15,21H,7-8,11-12H2,1-6H3/b19-13-,20-15+,23-14+ |
| InChIKey | UJVARQVCAKTCES-LHBIMTPLSA-N |
| XLogP | 6.33 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|