C8H10N2 — CID 123175711
3-ethenyl-5-methyliminopent-3-enenitrile (PubChem CID 123175711) has the molecular formula C8H10N2 and a molecular weight of 134.18 g/mol. Its IUPAC name is 3-ethenyl-5-methyliminopent-3-enenitrile.
| Compound Name | 3-ethenyl-5-methyliminopent-3-enenitrile |
|---|---|
| PubChem CID | 123175711 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 3-ethenyl-5-methyliminopent-3-enenitrile |
| SMILES | C=CC(=C/C=N/C)CC#N |
| InChI | InChI=1S/C8H10N2/c1-3-8(4-6-9)5-7-10-2/h3,5,7H,1,4H2,2H3/b8-5?,10-7+ |
| InChIKey | MDOVTBGPTKHJGS-NOFHWXGASA-N |
| XLogP | 1.71 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|