C10H17N — CID 123350584
5,6-dimethyl-2-propyl-2,3-dihydropyridine (PubChem CID 123350584) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 5,6-dimethyl-2-propyl-2,3-dihydropyridine.
| Compound Name | 5,6-dimethyl-2-propyl-2,3-dihydropyridine |
|---|---|
| PubChem CID | 123350584 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 5,6-dimethyl-2-propyl-2,3-dihydropyridine |
| SMILES | CCCC1CC=C(C)C(C)=N1 |
| InChI | InChI=1S/C10H17N/c1-4-5-10-7-6-8(2)9(3)11-10/h6,10H,4-5,7H2,1-3H3 |
| InChIKey | PEZNGEQLROXPSS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |