About 4-fluoro-5,6-dimethyl-2-propyl-2,3-dihydropyridine
4-fluoro-5,6-dimethyl-2-propyl-2,3-dihydropyridine (PubChem CID 90846019) has the molecular formula C10H16FN
and a molecular weight of 169.24 g/mol. Its IUPAC name is 4-fluoro-5,6-dimethyl-2-propyl-2,3-dihydropyridine.
Molecular Properties
| Compound Name | 4-fluoro-5,6-dimethyl-2-propyl-2,3-dihydropyridine |
| PubChem CID | 90846019 |
| Molecular Formula | C10H16FN |
| Molecular Weight | 169.24 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | 4-fluoro-5,6-dimethyl-2-propyl-2,3-dihydropyridine |
| SMILES | CCCC1CC(F)=C(C)C(C)=N1 |
| InChI | InChI=1S/C10H16FN/c1-4-5-9-6-10(11)7(2)8(3)12-9/h9H,4-6H2,1-3H3 |
| InChIKey | PAXMCHNMJRTVNH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.24 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-fluoro-5,6-dimethyl-2-propyl-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-5,6-dimethyl-2-propyl-2,3-dihydropyridine?
The IUPAC name of 4-fluoro-5,6-dimethyl-2-propyl-2,3-dihydropyridine (CID 90846019) is 4-fluoro-5,6-dimethyl-2-propyl-2,3-dihydropyridine.
What is the SMILES notation for 4-fluoro-5,6-dimethyl-2-propyl-2,3-dihydropyridine?
The canonical SMILES for 4-fluoro-5,6-dimethyl-2-propyl-2,3-dihydropyridine is CCCC1CC(F)=C(C)C(C)=N1.
What is the InChIKey of 4-fluoro-5,6-dimethyl-2-propyl-2,3-dihydropyridine?
The InChIKey is PAXMCHNMJRTVNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16FN/c1-4-5-9-6-10(11)7(2)8(3)12-9/h9H,4-6H2,1-3H3.
What are the key properties of 4-fluoro-5,6-dimethyl-2-propyl-2,3-dihydropyridine?
4-fluoro-5,6-dimethyl-2-propyl-2,3-dihydropyridine has a molecular weight of 169.24 g/mol, XLogP of 3.26, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-5,6-dimethyl-2-propyl-2,3-dihydropyridine is sourced from PubChem (CID 90846019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).