C10H18FN — CID 89330768
(E)-N,4-diethyl-5-fluorohex-4-en-3-imine (PubChem CID 89330768) has the molecular formula C10H18FN and a molecular weight of 171.26 g/mol. Its IUPAC name is (E)-N,4-diethyl-5-fluorohex-4-en-3-imine.
| Compound Name | (E)-N,4-diethyl-5-fluorohex-4-en-3-imine |
|---|---|
| PubChem CID | 89330768 |
| Molecular Formula | C10H18FN |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | (E)-N,4-diethyl-5-fluorohex-4-en-3-imine |
| SMILES | CC/N=C(CC)/C(CC)=C(\C)F |
| InChI | InChI=1S/C10H18FN/c1-5-9(8(4)11)10(6-2)12-7-3/h5-7H2,1-4H3/b9-8+,12-10+ |
| InChIKey | CDPIFFPQEHCNHI-CDKJVOIVSA-N |
| XLogP | 3.51 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|