C9H16N2 — CID 142380159
(E)-2-(C,N-dimethylcarbonimidoyl)but-2-enenitrile;ethane (PubChem CID 142380159) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is (E)-2-(C,N-dimethylcarbonimidoyl)but-2-enenitrile;ethane.
| Compound Name | (E)-2-(C,N-dimethylcarbonimidoyl)but-2-enenitrile;ethane |
|---|---|
| PubChem CID | 142380159 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (E)-2-(C,N-dimethylcarbonimidoyl)but-2-enenitrile;ethane |
| SMILES | C/C=C(C#N)\C(C)=N\C.CC |
| InChI | InChI=1S/C7H10N2.C2H6/c1-4-7(5-8)6(2)9-3;1-2/h4H,1-3H3;1-2H3/b7-4-,9-6+; |
| InChIKey | BUCHZBYUSMCVCL-XEAPTMNZSA-N |
| XLogP | 2.57 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|