C8H10N2 — CID 123676535
(2E)-2-methyl-4-methyliminohexa-2,5-dienenitrile (PubChem CID 123676535) has the molecular formula C8H10N2 and a molecular weight of 134.18 g/mol. Its IUPAC name is (2E)-2-methyl-4-methyliminohexa-2,5-dienenitrile.
| Compound Name | (2E)-2-methyl-4-methyliminohexa-2,5-dienenitrile |
|---|---|
| PubChem CID | 123676535 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | (2E)-2-methyl-4-methyliminohexa-2,5-dienenitrile |
| SMILES | C=CC(/C=C(\C)C#N)=N\C |
| InChI | InChI=1S/C8H10N2/c1-4-8(10-3)5-7(2)6-9/h4-5H,1H2,2-3H3/b7-5+,10-8+ |
| InChIKey | WGJXBMNNXXAOFN-RMTFUQJTSA-N |
| XLogP | 1.71 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|