C9H9FN2 — CID 123939725
3-fluoro-7-methyliminocyclohepta-1,5-diene-1-carbonitrile (PubChem CID 123939725) has the molecular formula C9H9FN2 and a molecular weight of 164.18 g/mol. Its IUPAC name is 3-fluoro-7-methyliminocyclohepta-1,5-diene-1-carbonitrile.
| Compound Name | 3-fluoro-7-methyliminocyclohepta-1,5-diene-1-carbonitrile |
|---|---|
| PubChem CID | 123939725 |
| Molecular Formula | C9H9FN2 |
| Molecular Weight | 164.18 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 3-fluoro-7-methyliminocyclohepta-1,5-diene-1-carbonitrile |
| SMILES | C/N=C1\C=CCC(F)C=C1C#N |
| InChI | InChI=1S/C9H9FN2/c1-12-9-4-2-3-8(10)5-7(9)6-11/h2,4-5,8H,3H2,1H3/b12-9+ |
| InChIKey | NPDBOMSDPSAPOC-FMIVXFBMSA-N |
| XLogP | 1.81 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.18 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|