C15H11N6- — CID 72512162
[8,9-dicyano-2-(C-cyano-N-methylcarbonimidoyl)-9-methyliminonona-1,3,5,7-tetraenylidene]azanide (PubChem CID 72512162) has the molecular formula C15H11N6- and a molecular weight of 275.30 g/mol. Its IUPAC name is [8,9-dicyano-2-(C-cyano-N-methylcarbonimidoyl)-9-methyliminonona-1,3,5,7-tetraenylidene]azanide.
| Compound Name | [8,9-dicyano-2-(C-cyano-N-methylcarbonimidoyl)-9-methyliminonona-1,3,5,7-tetraenylidene]azanide |
|---|---|
| PubChem CID | 72512162 |
| Molecular Formula | C15H11N6- |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | [8,9-dicyano-2-(C-cyano-N-methylcarbonimidoyl)-9-methyliminonona-1,3,5,7-tetraenylidene]azanide |
| SMILES | C/N=C(\C#N)C(=C=[N-])C=CC=CC=C(C#N)/C(C#N)=N/C |
| InChI | InChI=1S/C15H11N6/c1-20-14(10-18)12(8-16)6-4-3-5-7-13(9-17)15(11-19)21-2/h3-7H,1-2H3/q-1/b4-3?,7-5?,12-6?,20-14+,21-15+ |
| InChIKey | HIFYHZIMRLULRY-KGTZXKQQSA-N |
| XLogP | 1.90 |
| TPSA | 118.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|