C9H9FN2 — CID 144947229
6-fluoro-3,7-dimethyl-2H-azepine-5-carbonitrile (PubChem CID 144947229) has the molecular formula C9H9FN2 and a molecular weight of 164.18 g/mol. Its IUPAC name is 6-fluoro-3,7-dimethyl-2H-azepine-5-carbonitrile.
| Compound Name | 6-fluoro-3,7-dimethyl-2H-azepine-5-carbonitrile |
|---|---|
| PubChem CID | 144947229 |
| Molecular Formula | C9H9FN2 |
| Molecular Weight | 164.18 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 6-fluoro-3,7-dimethyl-2H-azepine-5-carbonitrile |
| SMILES | CC1=CC(C#N)=C(F)C(C)=NC1 |
| InChI | InChI=1S/C9H9FN2/c1-6-3-8(4-11)9(10)7(2)12-5-6/h3H,5H2,1-2H3 |
| InChIKey | VSGPFCAUWPQKAU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.18 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |