C14H15FN2 — CID 144726168
(E)-4-[(1E,3E,5E)-6-fluoro-3-methylocta-1,3,5,7-tetraenyl]iminopent-2-enenitrile (PubChem CID 144726168) has the molecular formula C14H15FN2 and a molecular weight of 230.29 g/mol. Its IUPAC name is (E)-4-[(1E,3E,5E)-6-fluoro-3-methylocta-1,3,5,7-tetraenyl]iminopent-2-enenitrile.
| Compound Name | (E)-4-[(1E,3E,5E)-6-fluoro-3-methylocta-1,3,5,7-tetraenyl]iminopent-2-enenitrile |
|---|---|
| PubChem CID | 144726168 |
| Molecular Formula | C14H15FN2 |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | (E)-4-[(1E,3E,5E)-6-fluoro-3-methylocta-1,3,5,7-tetraenyl]iminopent-2-enenitrile |
| SMILES | C=C/C(F)=C\C=C(C)\C=C\N=C(C)\C=C\C#N |
| InChI | InChI=1S/C14H15FN2/c1-4-14(15)8-7-12(2)9-11-17-13(3)6-5-10-16/h4-9,11H,1H2,2-3H3/b6-5+,11-9+,12-7+,14-8+,17-13+ |
| InChIKey | PIICWGONYLAQSF-ZGDKEYMUSA-N |
| XLogP | 4.03 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|