C10H12F3N — CID 176921225
(3E)-N-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]hexa-3,5-dien-2-imine (PubChem CID 176921225) has the molecular formula C10H12F3N and a molecular weight of 203.21 g/mol. Its IUPAC name is (3E)-N-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]hexa-3,5-dien-2-imine.
| Compound Name | (3E)-N-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]hexa-3,5-dien-2-imine |
|---|---|
| PubChem CID | 176921225 |
| Molecular Formula | C10H12F3N |
| Molecular Weight | 203.21 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | (3E)-N-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]hexa-3,5-dien-2-imine |
| SMILES | C=C/C=C/C(C)=N/C=C(\C)C(F)(F)F |
| InChI | InChI=1S/C10H12F3N/c1-4-5-6-9(3)14-7-8(2)10(11,12)13/h4-7H,1H2,2-3H3/b6-5+,8-7+,14-9+ |
| InChIKey | DFFNVVVIMVDOOX-VQSRGHASSA-N |
| XLogP | 3.66 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.21 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|