About 2-methyl-5-(trifluoromethyl)-3H-pyridin-3-ide;uranium
2-methyl-5-(trifluoromethyl)-3H-pyridin-3-ide;uranium (PubChem CID 59045579) has the molecular formula C7H5F3NU-
and a molecular weight of 398.15 g/mol. Its IUPAC name is 2-methyl-5-(trifluoromethyl)-3H-pyridin-3-ide;uranium.
Molecular Properties
| Compound Name | 2-methyl-5-(trifluoromethyl)-3H-pyridin-3-ide;uranium |
| PubChem CID | 59045579 |
| Molecular Formula | C7H5F3NU- |
| Molecular Weight | 398.15 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 2-methyl-5-(trifluoromethyl)-3H-pyridin-3-ide;uranium |
| SMILES | Cc1[c-]cc(C(F)(F)F)cn1.[U] |
| InChI | InChI=1S/C7H5F3N.U/c1-5-2-3-6(4-11-5)7(8,9)10;/h3-4H,1H3;/q-1; |
| InChIKey | YPSUXFOKPKIHJA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.15 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-5-(trifluoromethyl)-3H-pyridin-3-ide;uranium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-(trifluoromethyl)-3H-pyridin-3-ide;uranium?
The IUPAC name of 2-methyl-5-(trifluoromethyl)-3H-pyridin-3-ide;uranium (CID 59045579) is 2-methyl-5-(trifluoromethyl)-3H-pyridin-3-ide;uranium.
What is the SMILES notation for 2-methyl-5-(trifluoromethyl)-3H-pyridin-3-ide;uranium?
The canonical SMILES for 2-methyl-5-(trifluoromethyl)-3H-pyridin-3-ide;uranium is Cc1[c-]cc(C(F)(F)F)cn1.[U].
What is the InChIKey of 2-methyl-5-(trifluoromethyl)-3H-pyridin-3-ide;uranium?
The InChIKey is YPSUXFOKPKIHJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F3N.U/c1-5-2-3-6(4-11-5)7(8,9)10;/h3-4H,1H3;/q-1;.
What are the key properties of 2-methyl-5-(trifluoromethyl)-3H-pyridin-3-ide;uranium?
2-methyl-5-(trifluoromethyl)-3H-pyridin-3-ide;uranium has a molecular weight of 398.15 g/mol, XLogP of 2.21, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-(trifluoromethyl)-3H-pyridin-3-ide;uranium is sourced from PubChem (CID 59045579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).