About magnesium;hydride;6-(trifluoromethyl)-3H-pyridin-3-ide
magnesium;hydride;6-(trifluoromethyl)-3H-pyridin-3-ide (PubChem CID 164988655) has the molecular formula C6H4F3MgN
and a molecular weight of 171.40 g/mol. Its IUPAC name is magnesium;hydride;6-(trifluoromethyl)-3H-pyridin-3-ide.
Molecular Properties
| Compound Name | magnesium;hydride;6-(trifluoromethyl)-3H-pyridin-3-ide |
| PubChem CID | 164988655 |
| Molecular Formula | C6H4F3MgN |
| Molecular Weight | 171.40 g/mol |
| Exact Mass | 171.01 |
| IUPAC Name | magnesium;hydride;6-(trifluoromethyl)-3H-pyridin-3-ide |
| SMILES | FC(F)(F)c1cc[c-]cn1.[H-].[Mg+2] |
| InChI | InChI=1S/C6H3F3N.Mg.H/c7-6(8,9)5-3-1-2-4-10-5;;/h1,3-4H;;/q-1;+2;-1 |
| InChIKey | OUPLUGZZPYMGQU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze magnesium;hydride;6-(trifluoromethyl)-3H-pyridin-3-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;hydride;6-(trifluoromethyl)-3H-pyridin-3-ide?
The IUPAC name of magnesium;hydride;6-(trifluoromethyl)-3H-pyridin-3-ide (CID 164988655) is magnesium;hydride;6-(trifluoromethyl)-3H-pyridin-3-ide.
What is the SMILES notation for magnesium;hydride;6-(trifluoromethyl)-3H-pyridin-3-ide?
The canonical SMILES for magnesium;hydride;6-(trifluoromethyl)-3H-pyridin-3-ide is FC(F)(F)c1cc[c-]cn1.[H-].[Mg+2].
What is the InChIKey of magnesium;hydride;6-(trifluoromethyl)-3H-pyridin-3-ide?
The InChIKey is OUPLUGZZPYMGQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3F3N.Mg.H/c7-6(8,9)5-3-1-2-4-10-5;;/h1,3-4H;;/q-1;+2;-1.
What are the key properties of magnesium;hydride;6-(trifluoromethyl)-3H-pyridin-3-ide?
magnesium;hydride;6-(trifluoromethyl)-3H-pyridin-3-ide has a molecular weight of 171.40 g/mol, XLogP of 1.63, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;hydride;6-(trifluoromethyl)-3H-pyridin-3-ide is sourced from PubChem (CID 164988655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).