C11H14F3N — CID 163732423
(E)-N-[(1Z)-2-ethylbuta-1,3-dienyl]-1,1,1-trifluoropent-3-en-2-imine (PubChem CID 163732423) has the molecular formula C11H14F3N and a molecular weight of 217.23 g/mol. Its IUPAC name is (E)-N-[(1Z)-2-ethylbuta-1,3-dienyl]-1,1,1-trifluoropent-3-en-2-imine.
| Compound Name | (E)-N-[(1Z)-2-ethylbuta-1,3-dienyl]-1,1,1-trifluoropent-3-en-2-imine |
|---|---|
| PubChem CID | 163732423 |
| Molecular Formula | C11H14F3N |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | (E)-N-[(1Z)-2-ethylbuta-1,3-dienyl]-1,1,1-trifluoropent-3-en-2-imine |
| SMILES | C=C/C(=C\N=C(/C=C/C)C(F)(F)F)CC |
| InChI | InChI=1S/C11H14F3N/c1-4-7-10(11(12,13)14)15-8-9(5-2)6-3/h4-5,7-8H,2,6H2,1,3H3/b7-4+,9-8+,15-10+ |
| InChIKey | LASXSNZRZMAWAB-GQBKHQTNSA-N |
| XLogP | 4.05 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|