C10H14N2 — CID 143343942
N-[(4Z)-4-methylhexa-2,4-dienyl]ethanimidoyl cyanide (PubChem CID 143343942) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is N-[(4Z)-4-methylhexa-2,4-dienyl]ethanimidoyl cyanide.
| Compound Name | N-[(4Z)-4-methylhexa-2,4-dienyl]ethanimidoyl cyanide |
|---|---|
| PubChem CID | 143343942 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | N-[(4Z)-4-methylhexa-2,4-dienyl]ethanimidoyl cyanide |
| SMILES | C/C=C(/C)C=CC/N=C(\C)C#N |
| InChI | InChI=1S/C10H14N2/c1-4-9(2)6-5-7-12-10(3)8-11/h4-6H,7H2,1-3H3/b6-5?,9-4-,12-10+ |
| InChIKey | SXRBYRYKDBDWBL-FNMJXCSRSA-N |
| XLogP | 2.49 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|