C10H11N2Y+2 — CID 23395994
3-ethyl-5,6-dimethyl-4H-pyridin-4-ide-2-carbonitrile;yttrium(3+) (PubChem CID 23395994) has the molecular formula C10H11N2Y+2 and a molecular weight of 248.12 g/mol. Its IUPAC name is 3-ethyl-5,6-dimethyl-4H-pyridin-4-ide-2-carbonitrile;yttrium(3+).
| Compound Name | 3-ethyl-5,6-dimethyl-4H-pyridin-4-ide-2-carbonitrile;yttrium(3+) |
|---|---|
| PubChem CID | 23395994 |
| Molecular Formula | C10H11N2Y+2 |
| Molecular Weight | 248.12 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 3-ethyl-5,6-dimethyl-4H-pyridin-4-ide-2-carbonitrile;yttrium(3+) |
| SMILES | CCc1[c-]c(C)c(C)nc1C#N.[Y+3] |
| InChI | InChI=1S/C10H11N2.Y/c1-4-9-5-7(2)8(3)12-10(9)6-11;/h4H2,1-3H3;/q-1;+3 |
| InChIKey | BWOOIXOYUOOZGF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.12 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|