C8H12N2 — CID 143444705
2-(C,N-dimethylcarbonimidoyl)-3-methylbut-2-enenitrile (PubChem CID 143444705) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is 2-(C,N-dimethylcarbonimidoyl)-3-methylbut-2-enenitrile.
| Compound Name | 2-(C,N-dimethylcarbonimidoyl)-3-methylbut-2-enenitrile |
|---|---|
| PubChem CID | 143444705 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 2-(C,N-dimethylcarbonimidoyl)-3-methylbut-2-enenitrile |
| SMILES | C/N=C(\C)C(C#N)=C(C)C |
| InChI | InChI=1S/C8H12N2/c1-6(2)8(5-9)7(3)10-4/h1-4H3/b10-7+ |
| InChIKey | XZWXCMVZHWTUTC-JXMROGBWSA-N |
| XLogP | 1.94 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|