C13H18NY- — CID 59105237
2-but-1-en-2-yl-3-ethyl-5,6-dimethyl-4H-pyridin-4-ide;yttrium (PubChem CID 59105237) has the molecular formula C13H18NY- and a molecular weight of 277.20 g/mol. Its IUPAC name is 2-but-1-en-2-yl-3-ethyl-5,6-dimethyl-4H-pyridin-4-ide;yttrium.
| Compound Name | 2-but-1-en-2-yl-3-ethyl-5,6-dimethyl-4H-pyridin-4-ide;yttrium |
|---|---|
| PubChem CID | 59105237 |
| Molecular Formula | C13H18NY- |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 2-but-1-en-2-yl-3-ethyl-5,6-dimethyl-4H-pyridin-4-ide;yttrium |
| SMILES | C=C(CC)c1nc(C)c(C)[c-]c1CC.[Y] |
| InChI | InChI=1S/C13H18N.Y/c1-6-9(3)13-12(7-2)8-10(4)11(5)14-13;/h3,6-7H2,1-2,4-5H3;/q-1; |
| InChIKey | NCDDMULXUHSZAC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|