C12H12NY- — CID 59977116
2,3,4-trimethyl-8H-quinolin-8-ide;yttrium (PubChem CID 59977116) has the molecular formula C12H12NY- and a molecular weight of 259.14 g/mol. Its IUPAC name is 2,3,4-trimethyl-8H-quinolin-8-ide;yttrium.
| Compound Name | 2,3,4-trimethyl-8H-quinolin-8-ide;yttrium |
|---|---|
| PubChem CID | 59977116 |
| Molecular Formula | C12H12NY- |
| Molecular Weight | 259.14 g/mol |
| Exact Mass | 259.00 |
| IUPAC Name | 2,3,4-trimethyl-8H-quinolin-8-ide;yttrium |
| SMILES | Cc1nc2[c-]cccc2c(C)c1C.[Y] |
| InChI | InChI=1S/C12H12N.Y/c1-8-9(2)11-6-4-5-7-12(11)13-10(8)3;/h4-6H,1-3H3;/q-1; |
| InChIKey | NYBCQYHUHGUXFM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.14 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|