C14H21NY — CID 59105241
2-but-1-en-2-yl-3-ethyl-1,5,6-trimethyl-4H-pyridin-1-ium-4-ide;yttrium (PubChem CID 59105241) has the molecular formula C14H21NY and a molecular weight of 292.24 g/mol. Its IUPAC name is 2-but-1-en-2-yl-3-ethyl-1,5,6-trimethyl-4H-pyridin-1-ium-4-ide;yttrium.
| Compound Name | 2-but-1-en-2-yl-3-ethyl-1,5,6-trimethyl-4H-pyridin-1-ium-4-ide;yttrium |
|---|---|
| PubChem CID | 59105241 |
| Molecular Formula | C14H21NY |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 2-but-1-en-2-yl-3-ethyl-1,5,6-trimethyl-4H-pyridin-1-ium-4-ide;yttrium |
| SMILES | C=C(CC)c1c(CC)[c-]c(C)c(C)[n+]1C.[Y] |
| InChI | InChI=1S/C14H21N.Y/c1-7-10(3)14-13(8-2)9-11(4)12(5)15(14)6;/h3,7-8H2,1-2,4-6H3; |
| InChIKey | LVKXIURAMODQTF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|