C13H19NY — CID 159950958
5-ethyl-1,2,3-trimethyl-6-prop-1-en-2-yl-4H-pyridin-1-ium-4-ide;yttrium (PubChem CID 159950958) has the molecular formula C13H19NY and a molecular weight of 278.21 g/mol. Its IUPAC name is 5-ethyl-1,2,3-trimethyl-6-prop-1-en-2-yl-4H-pyridin-1-ium-4-ide;yttrium.
| Compound Name | 5-ethyl-1,2,3-trimethyl-6-prop-1-en-2-yl-4H-pyridin-1-ium-4-ide;yttrium |
|---|---|
| PubChem CID | 159950958 |
| Molecular Formula | C13H19NY |
| Molecular Weight | 278.21 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 5-ethyl-1,2,3-trimethyl-6-prop-1-en-2-yl-4H-pyridin-1-ium-4-ide;yttrium |
| SMILES | C=C(C)c1c(CC)[c-]c(C)c(C)[n+]1C.[Y] |
| InChI | InChI=1S/C13H19N.Y/c1-7-12-8-10(4)11(5)14(6)13(12)9(2)3;/h2,7H2,1,3-6H3; |
| InChIKey | OCCKQIHISWLFHC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.21 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|