C15H16N2 — CID 91390701
N,N-dimethyl-3-prop-1-enyl-2-azabicyclo[5.4.0]undeca-1,3,5,6,8,10-hexaen-4-amine (PubChem CID 91390701) has the molecular formula C15H16N2 and a molecular weight of 224.31 g/mol. Its IUPAC name is N,N-dimethyl-3-prop-1-enyl-2-azabicyclo[5.4.0]undeca-1,3,5,6,8,10-hexaen-4-amine.
| Compound Name | N,N-dimethyl-3-prop-1-enyl-2-azabicyclo[5.4.0]undeca-1,3,5,6,8,10-hexaen-4-amine |
|---|---|
| PubChem CID | 91390701 |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | N,N-dimethyl-3-prop-1-enyl-2-azabicyclo[5.4.0]undeca-1,3,5,6,8,10-hexaen-4-amine |
| SMILES | CC=CC1=C(N(C)C)C=C=c2ccccc2=N1 |
| InChI | InChI=1S/C15H16N2/c1-4-7-14-15(17(2)3)11-10-12-8-5-6-9-13(12)16-14/h4-9,11H,1-3H3 |
| InChIKey | SRXCKZCXOIRZMZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |