C10H13N — CID 59775903
2,4,5-trimethyl-3,6-dimethylidenepyridine (PubChem CID 59775903) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is 2,4,5-trimethyl-3,6-dimethylidenepyridine.
| Compound Name | 2,4,5-trimethyl-3,6-dimethylidenepyridine |
|---|---|
| PubChem CID | 59775903 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 2,4,5-trimethyl-3,6-dimethylidenepyridine |
| SMILES | C=c1nc(C)c(=C)c(C)c1C |
| InChI | InChI=1S/C10H13N/c1-6-7(2)9(4)11-10(5)8(6)3/h2,5H2,1,3-4H3 |
| InChIKey | ZIPBWENXPHLCND-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |