C8H12N2Y-2 — CID 58651167
carbanide;4,5,6-trimethyl-2H-pyrimidin-2-ide;yttrium (PubChem CID 58651167) has the molecular formula C8H12N2Y-2 and a molecular weight of 225.10 g/mol. Its IUPAC name is carbanide;4,5,6-trimethyl-2H-pyrimidin-2-ide;yttrium.
| Compound Name | carbanide;4,5,6-trimethyl-2H-pyrimidin-2-ide;yttrium |
|---|---|
| PubChem CID | 58651167 |
| Molecular Formula | C8H12N2Y-2 |
| Molecular Weight | 225.10 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | carbanide;4,5,6-trimethyl-2H-pyrimidin-2-ide;yttrium |
| SMILES | Cc1n[c-]nc(C)c1C.[CH3-].[Y] |
| InChI | InChI=1S/C7H9N2.CH3.Y/c1-5-6(2)8-4-9-7(5)3;;/h1-3H3;1H3;/q2*-1; |
| InChIKey | XIIMWLHUGXDLLT-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.10 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|