C6H6KN2Y- — CID 58291691
potassium;4,6-dimethyl-2,5-dihydropyrimidine-2,5-diide;yttrium (PubChem CID 58291691) has the molecular formula C6H6KN2Y- and a molecular weight of 234.13 g/mol. Its IUPAC name is potassium;4,6-dimethyl-2,5-dihydropyrimidine-2,5-diide;yttrium.
| Compound Name | potassium;4,6-dimethyl-2,5-dihydropyrimidine-2,5-diide;yttrium |
|---|---|
| PubChem CID | 58291691 |
| Molecular Formula | C6H6KN2Y- |
| Molecular Weight | 234.13 g/mol |
| Exact Mass | 233.92 |
| IUPAC Name | potassium;4,6-dimethyl-2,5-dihydropyrimidine-2,5-diide;yttrium |
| SMILES | Cc1[c-]c(C)n[c-]n1.[K+].[Y] |
| InChI | InChI=1S/C6H6N2.K.Y/c1-5-3-6(2)8-4-7-5;;/h1-2H3;;/q-2;+1; |
| InChIKey | PTOKWCNVXDJADN-UHFFFAOYSA-N |
| XLogP | -2.30 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.13 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|