C7H9N2Y4- — CID 58106162
4,5,6-trimethyl-2H-pyrimidin-2-ide;tetrakis(yttrium) (PubChem CID 58106162) has the molecular formula C7H9N2Y4- and a molecular weight of 476.79 g/mol. Its IUPAC name is 4,5,6-trimethyl-2H-pyrimidin-2-ide;tetrakis(yttrium).
| Compound Name | 4,5,6-trimethyl-2H-pyrimidin-2-ide;tetrakis(yttrium) |
|---|---|
| PubChem CID | 58106162 |
| Molecular Formula | C7H9N2Y4- |
| Molecular Weight | 476.79 g/mol |
| Exact Mass | 476.70 |
| IUPAC Name | 4,5,6-trimethyl-2H-pyrimidin-2-ide;tetrakis(yttrium) |
| SMILES | Cc1n[c-]nc(C)c1C.[Y].[Y].[Y].[Y] |
| InChI | InChI=1S/C7H9N2.4Y/c1-5-6(2)8-4-9-7(5)3;;;;/h1-3H3;;;;/q-1;;;; |
| InChIKey | QLVDATKTVKVLLR-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.79 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|