C6H6N2Y6-2 — CID 58120789
5,6-dimethyl-2,4-dihydropyrimidine-2,4-diide;hexakis(yttrium) (PubChem CID 58120789) has the molecular formula C6H6N2Y6-2 and a molecular weight of 639.56 g/mol. Its IUPAC name is 5,6-dimethyl-2,4-dihydropyrimidine-2,4-diide;hexakis(yttrium).
| Compound Name | 5,6-dimethyl-2,4-dihydropyrimidine-2,4-diide;hexakis(yttrium) |
|---|---|
| PubChem CID | 58120789 |
| Molecular Formula | C6H6N2Y6-2 |
| Molecular Weight | 639.56 g/mol |
| Exact Mass | 639.49 |
| IUPAC Name | 5,6-dimethyl-2,4-dihydropyrimidine-2,4-diide;hexakis(yttrium) |
| SMILES | Cc1[c-]n[c-]nc1C.[Y].[Y].[Y].[Y].[Y].[Y] |
| InChI | InChI=1S/C6H6N2.6Y/c1-5-3-7-4-8-6(5)2;;;;;;/h1-2H3;;;;;;/q-2;;;;;; |
| InChIKey | KPBGDYJPWWRTNT-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.56 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|