C6H6N2Y2-2 — CID 59098087
2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide;bis(yttrium) (PubChem CID 59098087) has the molecular formula C6H6N2Y2-2 and a molecular weight of 283.94 g/mol. Its IUPAC name is 2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide;bis(yttrium).
| Compound Name | 2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide;bis(yttrium) |
|---|---|
| PubChem CID | 59098087 |
| Molecular Formula | C6H6N2Y2-2 |
| Molecular Weight | 283.94 g/mol |
| Exact Mass | 283.87 |
| IUPAC Name | 2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide;bis(yttrium) |
| SMILES | Cc1[c-]nc(C)n[c-]1.[Y].[Y] |
| InChI | InChI=1S/C6H6N2.2Y/c1-5-3-7-6(2)8-4-5;;/h1-2H3;;/q-2;; |
| InChIKey | ZFWXQWNBNXWGKB-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.94 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|