C6H6K2N2 — CID 18712653
dipotassium;2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide (PubChem CID 18712653) has the molecular formula C6H6K2N2 and a molecular weight of 184.32 g/mol. Its IUPAC name is dipotassium;2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide.
| Compound Name | dipotassium;2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide |
|---|---|
| PubChem CID | 18712653 |
| Molecular Formula | C6H6K2N2 |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 183.98 |
| IUPAC Name | dipotassium;2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide |
| SMILES | Cc1[c-]nc(C)n[c-]1.[K+].[K+] |
| InChI | InChI=1S/C6H6N2.2K/c1-5-3-7-6(2)8-4-5;;/h1-2H3;;/q-2;2*+1 |
| InChIKey | SYFLRAARHJDZKC-UHFFFAOYSA-N |
| XLogP | -5.30 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | -5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|