About dipotassium;2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide
dipotassium;2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide (PubChem CID 18712653) has the molecular formula C6H6K2N2
and a molecular weight of 184.32 g/mol. Its IUPAC name is dipotassium;2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide.
Molecular Properties
| Compound Name | dipotassium;2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide |
| PubChem CID | 18712653 |
| Molecular Formula | C6H6K2N2 |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 183.98 |
| IUPAC Name | dipotassium;2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide |
| SMILES | Cc1[c-]nc(C)n[c-]1.[K+].[K+] |
| InChI | InChI=1S/C6H6N2.2K/c1-5-3-7-6(2)8-4-5;;/h1-2H3;;/q-2;2*+1 |
| InChIKey | SYFLRAARHJDZKC-UHFFFAOYSA-N |
| XLogP | -5.30 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | -5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide?
The IUPAC name of dipotassium;2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide (CID 18712653) is dipotassium;2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide.
What is the SMILES notation for dipotassium;2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide?
The canonical SMILES for dipotassium;2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide is Cc1[c-]nc(C)n[c-]1.[K+].[K+].
What is the InChIKey of dipotassium;2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide?
The InChIKey is SYFLRAARHJDZKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2.2K/c1-5-3-7-6(2)8-4-5;;/h1-2H3;;/q-2;2*+1.
What are the key properties of dipotassium;2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide?
dipotassium;2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide has a molecular weight of 184.32 g/mol, XLogP of -5.30, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide is sourced from PubChem (CID 18712653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).